CAS 92585-24-5

2-Methyl-4-phenyl-1-pentanol

Description:

2-Methyl-4-phenyl-1-pentanol is an organic compound characterized by its structure, which includes a pentanol backbone with a methyl group and a phenyl group attached to the carbon chain. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate solubility in water, largely due to the hydrophobic nature of the phenyl group. It has a relatively high boiling point compared to simpler alcohols, reflecting the influence of its larger molecular structure. The presence of both hydrophobic and hydrophilic regions in its molecular structure allows it to participate in various chemical reactions, including those typical of alcohols, such as oxidation and esterification. Additionally, 2-Methyl-4-phenyl-1-pentanol may exhibit interesting properties in terms of its potential applications in organic synthesis, pharmaceuticals, or as a solvent, although specific applications may vary based on further research and development. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₂H₁₈O

InChI: InChI=1S/C12H18O/c1-10(9-13)8-11(2)12-6-4-3-5-7-12/h3-7,10-11,13H,8-9H2,1-2H3

InChI key: InChIKey=SXGYZCMGVZKIPJ-UHFFFAOYSA-N

SMILES: C(CC(CO)C)(C)C1=CC=CC=C1

Synonyms:

• 2-Methyl-4-phenyl-1-pentanol
• Pamplefleur
• 2-Methyl-4-phenylpentanol
• Benzenebutanol, β,δ-dimethyl-
• β,δ-Dimethylbenzenebutanol