CAS 925889-77-6
:tert-butyl 2-(aminomethyl)-3-[4-(trifluoromethyl)phenyl]propanoate
Description:
Tert-butyl 2-(aminomethyl)-3-[4-(trifluoromethyl)phenyl]propanoate, identified by its CAS number 925889-77-6, is a chemical compound characterized by its complex structure, which includes a tert-butyl ester group, an aminomethyl substituent, and a trifluoromethylphenyl moiety. This compound typically exhibits properties associated with both amines and esters, such as potential solubility in organic solvents and reactivity due to the presence of the amino group. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's structural features may confer specific pharmacological properties, making it a candidate for further investigation in drug development or as a synthetic intermediate in organic synthesis. Overall, its unique combination of functional groups and structural characteristics positions it as a versatile compound in chemical research.
Formula:C15H20F3NO2
InChI:InChI=1/C15H20F3NO2/c1-14(2,3)21-13(20)11(9-19)8-10-4-6-12(7-5-10)15(16,17)18/h4-7,11H,8-9,19H2,1-3H3
SMILES:CC(C)(C)OC(=O)C(Cc1ccc(cc1)C(F)(F)F)CN
Synonyms:- tert-Butyl 3-amino-2-[4-(trifluoromethyl)benzyl]propanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 2-(aminomethyl)-3-(4-(trifluoromethyl)phenyl)propanoate
CAS:Formula:C15H20F3NO2Molecular weight:303.3200
