CAS 925890-01-3
:3-oxopiperidine-2-carboxylic acid
Description:
3-Oxopiperidine-2-carboxylic acid, identified by its CAS number 925890-01-3, is a heterocyclic organic compound featuring a piperidine ring with a ketone and a carboxylic acid functional group. This compound typically exhibits characteristics common to piperidine derivatives, including a cyclic structure that contributes to its stability and reactivity. The presence of the oxo group (ketone) and the carboxylic acid group enhances its potential for various chemical reactions, such as nucleophilic attacks and esterification. It is likely to be soluble in polar solvents due to the carboxylic acid functionality, which can engage in hydrogen bonding. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in synthesizing pharmaceuticals or as intermediates in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C6H9NO3
InChI:InChI=1/C6H9NO3/c8-4-2-1-3-7-5(4)6(9)10/h5,7H,1-3H2,(H,9,10)
SMILES:C1CC(=O)C(C(=O)O)NC1
Synonyms:- 2-Piperidinecarboxylic Acid, 3-Oxo-
- 3-Oxopiperidine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.