CAS 925890-66-0

N-(7-chlorothieno[3,2-c]pyridin-4-yl)ethane-1,2-diamine

Description:

N-(7-chlorothieno[3,2-c]pyridin-4-yl)ethane-1,2-diamine is a chemical compound characterized by its unique structure, which includes a thieno[3,2-c]pyridine moiety substituted with a chlorine atom and an ethane-1,2-diamine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, including potential solubility in polar solvents due to the presence of amino groups. The thieno[3,2-c]pyridine core contributes to its biological activity, making it of interest in medicinal chemistry, particularly for its potential pharmacological applications. The chlorine substituent may influence its reactivity and interaction with biological targets. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its stability and reactivity. Overall, N-(7-chlorothieno[3,2-c]pyridin-4-yl)ethane-1,2-diamine is a compound of interest for research in drug development and related fields.

Formula: C₉H₁₀ClN₃S

InChI: InChI=1/C9H10ClN3S/c10-7-5-13-9(12-3-2-11)6-1-4-14-8(6)7/h1,4-5H,2-3,11H2,(H,12,13)

4-(2-Aminoethyl)amino-7-chlorothieno[3,2-c]pyridine

CAS: 925890-66-0

4-(2-Aminoethyl)amino-7-chlorothieno[3,2-c]pyridine

Purity: 95%

Molecular weight: 227.7138g/mol

Ref: 54-OR1076185