CAS 925932-10-1

Secaubrytriol

Description:

Secaubrytriol, identified by its CAS number 925932-10-1, is a chemical compound that belongs to the class of triols, which are characterized by having three hydroxyl (-OH) functional groups. While specific details about its physical and chemical properties may not be widely documented, compounds in this category typically exhibit high solubility in water due to the presence of multiple hydroxyl groups, which can engage in hydrogen bonding. This solubility can influence its reactivity and interactions with other substances. Additionally, triols often serve as intermediates in organic synthesis and can be utilized in various applications, including pharmaceuticals, cosmetics, and as building blocks in polymer chemistry. The presence of multiple hydroxyl groups may also impart certain biological activities, making such compounds of interest in medicinal chemistry. However, for precise characteristics such as melting point, boiling point, and specific applications, further empirical data or literature references would be necessary.

Formula: C₃₀H₅₀O₅

InChI: InChI=1S/C30H50O5/c1-19(7-10-24(32)26(3,4)35)21-11-13-28(6)23-9-8-22(20(2)17-31)29(14-12-25(33)34)18-30(23,29)16-15-27(21,28)5/h19,21-24,31-32,35H,2,7-18H2,1,3-6H3,(H,33,34)/t19-,21-,22+,23+,24-,27-,28+,29-,30+/m1/s1

InChI key: InChIKey=NFSDEMPRAKPPFK-HIGWZERASA-N

SMILES: C(CC(O)=O)[C@]12[C@]3([C@]([C@@]4(C)[C@](C)(CC3)[C@@]([C@@H](CC[C@H](C(C)(C)O)O)C)(CC4)[H])(CC[C@H]1C(CO)=C)[H])C2

Synonyms:

• (3R,3aR,4aS,6aR,7R,9aS,9bS)-7-[(1R,4R)-4,5-Dihydroxy-1,5-dimethylhexyl]decahydro-3-[1-(hydroxymethyl)ethenyl]-6a,9a-dimethyl-1H-cyclopenta[a]cyclopropa[e]naphthalene-3a(4H)-propanoic acid
• Secaubrytriol
• 1H-Cyclopenta[a]cyclopropa[e]naphthalene-3a(4H)-propanoic acid, 7-[(1R,4R)-4,5-dihydroxy-1,5-dimethylhexyl]decahydro-3-[1-(hydroxymethyl)ethenyl]-6a,9a-dimethyl-, (3R,3aR,4aS,6aR,7R,9aS,9bS)-

Secaubrytriol

CAS: 925932-10-1

Secaubrytriol is a synthetic compound, which is a product of advanced chemical engineering and synthesis. It is derived from complex organic reactions involving strategic modifications of molecular structures to optimize its efficacy. The mode of action of Secaubrytriol involves selective binding to specific cellular targets, influencing biochemical pathways at a molecular level. This binding alters enzymatic activity, leading to enhanced metabolic processes or altered gene expression patterns, depending on the application context.

Formula: C₃₀H₅₀O₅

Purity: Min. 95%

Molecular weight: 490.7 g/mol

Ref: 3D-AMB93210