CymitQuimica logo

CAS 92599-77-4

:

benzyl 2,3-bis(acetyloxy)piperidine-1-carboxylate

Description:
Benzyl 2,3-bis(acetyloxy)piperidine-1-carboxylate is a chemical compound characterized by its piperidine core, which is a six-membered nitrogen-containing ring. This compound features two acetoxy groups (–OCOCH3) attached to the 2 and 3 positions of the piperidine ring, enhancing its reactivity and solubility in organic solvents. The benzyl group (–C6H5CH2) at the nitrogen atom contributes to its lipophilicity, making it more soluble in non-polar solvents. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification or nucleophilic substitution. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its structural features suggest it could interact with biological systems, although specific biological activity would require further investigation. Overall, benzyl 2,3-bis(acetyloxy)piperidine-1-carboxylate is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C17H21NO6
InChI:InChI=1/C17H21NO6/c1-12(19)23-15-9-6-10-18(16(15)24-13(2)20)17(21)22-11-14-7-4-3-5-8-14/h3-5,7-8,15-16H,6,9-11H2,1-2H3
SMILES:CC(=O)OC1CCCN(C1OC(=O)C)C(=O)OCc1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.