CAS 926-54-5
:(3E)-2-Methyl-1,3-pentadiene
Description:
(3E)-2-Methyl-1,3-pentadiene, also known as isoprene, is a colorless liquid hydrocarbon with a characteristic odor. It is classified as a diene due to the presence of two double bonds in its structure, specifically in a conjugated system, which contributes to its reactivity and chemical properties. The compound has a molecular formula of C5H8 and is known for its role as a building block in the synthesis of various polymers, most notably natural rubber. Isoprene is highly flammable and should be handled with care, as it can form explosive mixtures with air. Its boiling point is relatively low, making it volatile, and it is soluble in organic solvents but less so in water. The compound is also a precursor in the production of several important chemicals and materials, including synthetic rubber and various pharmaceuticals. Due to its reactivity, isoprene can undergo polymerization and other chemical reactions, making it significant in both industrial applications and organic synthesis.
Formula:C6H10
InChI:InChI=1S/C6H10/c1-4-5-6(2)3/h4-5H,2H2,1,3H3/b5-4+
InChI key:InChIKey=RCJMVGJKROQDCB-SNAWJCMRSA-N
SMILES:C(\C(C)=C)=C/C
Synonyms:- (3E)-2-Methyl-1,3-pentadiene
- (E)-2-Methyl-1,3-pentadiene
- 1,3-Pentadiene, 2-methyl-, (3E)-
- 1,3-Pentadiene, 2-methyl-, (E)-
- 1,3-Pentadiene, 2-methyl-, trans-
- 2-Methyl-1-trans-3-pentadiene
- 2-Methyl-trans-1,3-pentadiene
- trans-2-Methylpenta-1,3-diene
- trans-2-Methylpentadiene
- trans-2-Methyl-1,3-pentadiene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
trans-2-Methyl-1,3-pentadiene
CAS:Trans-2-methyl-1,3-pentadiene is a polymerized molecule that is derived from the β-unsaturated ketone. It has a molecular weight of 132.14 g/mol and an isolated yield of 10%. Trans-2-methyl-1,3-pentadiene has been shown to undergo cationic polymerization with lithium aluminum hydride (LAH) as the catalyst to form polymers. The two isomers are cis and trans and have different energy requirements for activation. This reaction can be done at room temperature in THF using potassium tetrachloroplatinate (KPtCl) as a catalyst. Trans-2-methyl-1,3 pentadiene can also be used for size exclusion chromatography in water or organic solvents such as cyclohexane or hexane.Formula:C6H10Purity:90%MinMolecular weight:82.14 g/mol
