CAS 926004-74-2
:4-Iodo-5-methoxy-1H-pyrrolo[2,3-b]pyridine
Description:
4-Iodo-5-methoxy-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both a pyridine and a pyrrole ring. The presence of an iodine atom at the 4-position and a methoxy group at the 5-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen and methoxy substituents that can influence biological interactions. The compound may also be of interest in materials science and organic synthesis. As with many heterocycles, it may exhibit interesting electronic properties and could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety and handling precautions should be observed, as iodine-containing compounds can pose health risks.
Formula:C8H7IN2O
InChI:InChI=1S/C8H7IN2O/c1-12-6-4-11-8-5(7(6)9)2-3-10-8/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=RXRHPWNAHWJKHD-UHFFFAOYSA-N
SMILES:IC1=C2C(=NC=C1OC)NC=C2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 4-iodo-5-methoxy-
- 5-Methoxy-4-iodo-1H-pyrrolo[2,3-b]pyridine
- 4-Iodo-5-methoxy-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

