CAS 92608-26-9

1-Methyl-1,7-diazaspiro[4.5]decan-6-one

Description:

1-Methyl-1,7-diazaspiro[4.5]decan-6-one is a bicyclic organic compound characterized by its unique spiro structure, which consists of a nitrogen-containing ring system. The presence of two nitrogen atoms in the diaza configuration contributes to its potential as a pharmacophore in medicinal chemistry. This compound features a ketone functional group, which can influence its reactivity and interactions with biological targets. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of nitrogen and oxygen atoms, affecting their solubility in various solvents. The spirocyclic nature often imparts rigidity to the molecular structure, which can be advantageous in drug design for enhancing binding affinity to specific receptors. Additionally, the methyl group attached to the nitrogen atom may influence the compound's steric and electronic properties, potentially affecting its biological activity. Overall, 1-Methyl-1,7-diazaspiro[4.5]decan-6-one represents a class of compounds that may have applications in pharmaceuticals, particularly in the development of novel therapeutic agents.

Formula: C₉H₁₆N₂O

InChI: InChI=1S/C9H16N2O/c1-11-7-3-5-9(11)4-2-6-10-8(9)12/h2-7H2,1H3,(H,10,12)

InChI key: InChIKey=TZCLEYJRINDBTK-UHFFFAOYSA-N

SMILES: CN1C2(C(=O)NCCC2)CCC1

Synonyms:

• 1,7-Diazaspiro[4.5]decan-6-one, 1-methyl-
• 1-Methyl-1,7-diazaspiro[4.5]decan-6-one