CAS 92609-77-3

7,9,12-Trihydroxy-2,2-dimethyl-2H,6H-pyrano[3,2-b]xanthen-6-one

Description:

7,9,12-Trihydroxy-2,2-dimethyl-2H,6H-pyrano[3,2-b]xanthen-6-one, with the CAS number 92609-77-3, is a synthetic organic compound that belongs to the class of xanthenes, which are characterized by their fused ring structures. This compound features multiple hydroxyl (-OH) groups, contributing to its potential solubility in polar solvents and influencing its reactivity and biological activity. The presence of the pyran ring adds to its structural complexity, which may impart unique optical properties, making it of interest in various applications, including dyes and pigments. The compound's hydroxyl groups can participate in hydrogen bonding, enhancing its interactions with other molecules. Additionally, its dimethyl substitution may affect its steric properties and stability. Overall, this compound's unique structure and functional groups suggest potential utility in fields such as materials science, organic synthesis, and medicinal chemistry, although specific applications would depend on further research into its properties and behavior in different environments.

Formula: C₁₈H₁₄O₆

InChI: InChI=1S/C18H14O6/c1-18(2)4-3-8-5-10-14(21)13-11(20)6-9(19)7-12(13)23-17(10)15(22)16(8)24-18/h3-7,19-20,22H,1-2H3

InChI key: InChIKey=WBKWHYDUDXOZIU-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC=3C1=CC4=C(C3O)OC(C)(C)C=C4)=CC(O)=CC2O

Synonyms:

• 2H,6H-Pyrano[3,2-b]xanthen-6-one, 7,9,12-trihydroxy-2,2-dimethyl-
• 7,9,12-Trihydroxy-2,2-dimethyl-2H,6H-pyrano[3,2-b]xanthen-6-one

O-Demethylforbexanthone

CAS: 92609-77-3

Formula: C₁₈H₁₄O₆

Molecular weight: 326.3002

Ref: IN-DA00H0HF

O-Demethylforbexanthone

CAS: 92609-77-3

O-Demethylforbexanthone is a natural product for research related to life sciences. The catalog number is TN4686 and the CAS number is 92609-77-3.

Formula: C₁₈H₁₄O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 326.3

Ref: TM-TN4686

O-Demethylforbexanthone

CAS: 92609-77-3

Formula: C₁₈H₁₄O₆

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 326.304

Ref: BP-SBP02060

o-Demethylforbexanthone

CAS: 92609-77-3

o-Demethylforbexanthone is a synthetic xanthone derivative, which is typically sourced from chemical modifications of naturally occurring xanthones. These modifications are conducted in the laboratory setting to enhance certain biological properties. The mode of action of o-Demethylforbexanthone involves interaction with cellular pathways that could lead to apoptosis in target cells, suggesting its role as a potential therapeutic agent for cancer research.

Formula: C₁₈H₁₄O₆

Purity: Min. 95%

Molecular weight: 326.3 g/mol

Ref: 3D-SDA60977