CAS 926185-86-6

N-Cyclopropyl-2,4-dimethylbenzenemethanamine

Description:

N-Cyclopropyl-2,4-dimethylbenzenemethanamine, identified by its CAS number 926185-86-6, is a chemical compound characterized by its unique structure, which includes a cyclopropyl group and a dimethyl-substituted benzene ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the cyclopropyl group can influence its steric and electronic properties, potentially affecting its reactivity and interactions with biological targets. The dimethyl substitutions on the benzene ring may enhance lipophilicity, impacting its solubility in organic solvents and biological membranes. As with many amines, it may also participate in various chemical reactions, including alkylation and acylation. The compound's specific applications and biological activity would depend on its interaction with various receptors or enzymes, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₇N

InChI: InChI=1S/C12H17N/c1-9-3-4-11(10(2)7-9)8-13-12-5-6-12/h3-4,7,12-13H,5-6,8H2,1-2H3

InChI key: InChIKey=QHEGOFDTGUINIS-UHFFFAOYSA-N

SMILES: C(NC1CC1)C2=C(C)C=C(C)C=C2

Synonyms:

• N-Cyclopropyl-2,4-dimethylbenzenemethanamine
• Benzenemethanamine, N-cyclopropyl-2,4-dimethyl-