CAS 926191-91-5

1-(1,4-diazepan-1-yl)-2-methoxyethanone

Description:

1-(1,4-diazepan-1-yl)-2-methoxyethanone, with the CAS number 926191-91-5, is a chemical compound characterized by its unique structural features. It contains a diazepane ring, which is a seven-membered heterocyclic compound containing two nitrogen atoms, contributing to its potential biological activity. The methoxyethanone group indicates the presence of a methoxy functional group attached to an ethanone moiety, which may influence its reactivity and solubility. This compound is likely to exhibit properties typical of both amines and ketones, including potential hydrogen bonding capabilities and reactivity towards electrophiles. Its molecular structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the diazepane's association with various biological activities. Additionally, the presence of the methoxy group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. Overall, 1-(1,4-diazepan-1-yl)-2-methoxyethanone represents a compound with intriguing characteristics that warrant further investigation in chemical and biological contexts.

Formula: C₈H₁₆N₂O₂

InChI: InChI=1/C8H16N2O2/c1-12-7-8(11)10-5-2-3-9-4-6-10/h9H,2-7H2,1H3

SMILES: COCC(=O)N1CCCNCC1

Synonyms:

• 1-(Methoxyacetyl)-1,4-Diazepane
• ethanone, 1-(hexahydro-1H-1,4-diazepin-1-yl)-2-methoxy-