CAS 926194-19-6
:N-(5-amino-2-methoxyphenyl)-2-methoxyacetamide
Description:
N-(5-amino-2-methoxyphenyl)-2-methoxyacetamide, identified by its CAS number 926194-19-6, is a chemical compound characterized by its amide functional group and aromatic structure. This substance features a methoxy group, which enhances its solubility in organic solvents and may influence its biological activity. The presence of the amino group suggests potential for hydrogen bonding, which can affect its interaction with biological targets. The compound's structure indicates it may exhibit properties typical of both amines and amides, such as moderate polarity and potential reactivity under certain conditions. Its specific applications or biological activities would depend on further studies, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. Additionally, the methoxy groups may contribute to the compound's lipophilicity, influencing its pharmacokinetic properties. Overall, N-(5-amino-2-methoxyphenyl)-2-methoxyacetamide represents a class of compounds that may have significant implications in drug development and research.
Formula:C10H14N2O3
InChI:InChI=1/C10H14N2O3/c1-14-6-10(13)12-8-5-7(11)3-4-9(8)15-2/h3-5H,6,11H2,1-2H3,(H,12,13)
SMILES:COCC(=Nc1cc(ccc1OC)N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
