CAS 926196-71-6

6-Bromo-2-[2-(3-methoxyphenyl)ethenyl]-4-quinolinecarboxylic acid

Description:

6-Bromo-2-[2-(3-methoxyphenyl)ethenyl]-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, a bromine substituent, and a methoxyphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the bromine atom may enhance its reactivity, making it suitable for further functionalization or as a building block in organic synthesis. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, which can influence its behavior in biological systems or chemical reactions. Additionally, the methoxy group can affect the compound's electronic properties and steric hindrance, potentially impacting its biological activity. Overall, this compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development or as a research tool in studying biological pathways.

Formula: C₁₉H₁₄BrNO₃

InChI: InChI=1S/C19H14BrNO3/c1-24-15-4-2-3-12(9-15)5-7-14-11-17(19(22)23)16-10-13(20)6-8-18(16)21-14/h2-11H,1H3,(H,22,23)

InChI key: InChIKey=AULMKKDSDFPSRM-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C=CC3=CC(OC)=CC=C3)C1)C=CC(Br)=C2

Synonyms:

• 6-Bromo-2-[2-(3-methoxyphenyl)ethenyl]-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 6-bromo-2-[2-(3-methoxyphenyl)ethenyl]-

6-Bromo-2-[2-(3-methoxyphenyl)ethenyl]quinoline-4-carboxylic acid

CAS: 926196-71-6

Versatile small molecule scaffold

Formula: C₁₉H₁₄BrNO₃

Purity: Min. 95%

Molecular weight: 384.2 g/mol

Ref: 3D-BMB19671