CAS 926198-07-4

2-Hydroxy-5-[(2-pyridinylcarbonyl)amino]benzoic acid

Description:

2-Hydroxy-5-[(2-pyridinylcarbonyl)amino]benzoic acid, also known by its CAS number 926198-07-4, is a chemical compound characterized by its structural features that include a hydroxyl group and an amino group attached to a benzoic acid framework. This compound exhibits both acidic and basic properties due to the presence of the carboxylic acid and amino functional groups, allowing it to participate in various chemical reactions, including hydrogen bonding and coordination with metal ions. The pyridine ring contributes to its potential as a ligand in coordination chemistry, enhancing its reactivity and interaction with other molecules. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility in polar solvents and stability under standard conditions are typical for similar aromatic compounds. Overall, 2-Hydroxy-5-[(2-pyridinylcarbonyl)amino]benzoic acid is a versatile compound with potential applications in medicinal chemistry and materials science.

Formula: C₁₃H₁₀N₂O₄

InChI: InChI=1S/C13H10N2O4/c16-11-5-4-8(7-9(11)13(18)19)15-12(17)10-3-1-2-6-14-10/h1-7,16H,(H,15,17)(H,18,19)

InChI key: InChIKey=OCJWRWGQCYNMJL-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=CC=N1)C2=CC(C(O)=O)=C(O)C=C2

Synonyms:

• Benzoic acid, 2-hydroxy-5-[(2-pyridinylcarbonyl)amino]-
• 2-Hydroxy-5-[(2-pyridinylcarbonyl)amino]benzoic acid

2-Hydroxy-5-(pyridine-2-amido)benzoic acid

CAS: 926198-07-4

Versatile small molecule scaffold

Formula: C₁₃H₁₀N₂O₄

Purity: Min. 95%

Molecular weight: 258.23 g/mol

Ref: 3D-BMB19807