CAS 926199-81-7

6-Bromo-2-[2-[4-(trifluoromethoxy)phenyl]ethenyl]-4-quinolinecarboxylic acid

Description:

6-Bromo-2-[2-[4-(trifluoromethoxy)phenyl]ethenyl]-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, a bromine substituent, and a trifluoromethoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the bromine atom enhances its reactivity, while the trifluoromethoxy group may impart unique electronic properties, influencing its solubility and interaction with biological targets. The carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. This compound may be of interest in medicinal chemistry, particularly for its potential biological activity, which could include antimicrobial or anticancer properties. Its structural features suggest that it could participate in various chemical reactions, making it a candidate for further research in drug development or material science. As with many synthetic compounds, safety and handling precautions should be observed due to its chemical nature.

Formula: C₁₉H₁₁BrF₃NO₃

InChI: InChI=1S/C19H11BrF3NO3/c20-12-4-8-17-15(9-12)16(18(25)26)10-13(24-17)5-1-11-2-6-14(7-3-11)27-19(21,22)23/h1-10H,(H,25,26)

InChI key: InChIKey=FGVBJYYHLUKJOO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C=CC3=CC=C(OC(F)(F)F)C=C3)C1)C=CC(Br)=C2

Synonyms:

• 6-Bromo-2-[2-[4-(trifluoromethoxy)phenyl]ethenyl]-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 6-bromo-2-[2-[4-(trifluoromethoxy)phenyl]ethenyl]-

6-Bromo-2-{2-[4-(trifluoromethoxy)phenyl]ethenyl}quinoline-4-carboxylic acid

CAS: 926199-81-7

Versatile small molecule scaffold

Formula: C₁₉H₁₁BrF₃NO₃

Purity: Min. 95%

Molecular weight: 438.2 g/mol

Ref: 3D-BMB19981