CymitQuimica logo

CAS 926200-13-7

:

2-chloro-5-(1H-tetrazol-1-yl)aniline

Description:
2-Chloro-5-(1H-tetrazol-1-yl)aniline is a chemical compound characterized by its unique structure, which includes a chloro group and a tetrazole moiety attached to an aniline backbone. This compound typically exhibits properties associated with both aromatic amines and heterocyclic compounds. It is likely to be a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the tetrazole group, which can engage in hydrogen bonding. The chloro substituent may influence its reactivity, making it a candidate for various chemical transformations. Additionally, the tetrazole ring can impart interesting biological activities, as tetrazoles are often found in pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may participate in electrophilic aromatic substitution reactions and could serve as a precursor for synthesizing more complex molecules. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C7H6ClN5
InChI:InChI=1/C7H6ClN5/c8-6-2-1-5(3-7(6)9)13-4-10-11-12-13/h1-4H,9H2
SMILES:c1cc(c(cc1n1cnnn1)N)Cl
Synonyms:
  • 2-chloro-5-(1H-tetraazol-1-yl)aniline
  • benzenamine, 2-chloro-5-(1H-tetrazol-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.