CymitQuimica logo

CAS 926201-28-7

:

3-amino-4-chloro-N-propylbenzamide

Description:
3-Amino-4-chloro-N-propylbenzamide is an organic compound characterized by the presence of an amine group, a chloro substituent, and a propyl group attached to a benzamide structure. The compound features a benzene ring with an amino group (-NH2) positioned at the meta (3) position and a chlorine atom at the para (4) position relative to the amine. The N-propyl group indicates that a propyl chain is attached to the nitrogen of the amide functional group. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the amine and carbonyl functionalities. The presence of the chlorine atom may influence its reactivity and biological activity, potentially making it a candidate for various applications in pharmaceuticals or agrochemicals. As with many organic compounds, its stability, reactivity, and interactions will depend on environmental conditions such as pH and temperature.
Formula:C10H13ClN2O
InChI:InChI=1/C10H13ClN2O/c1-2-5-13-10(14)7-3-4-8(11)9(12)6-7/h3-4,6H,2,5,12H2,1H3,(H,13,14)
SMILES:CCCN=C(c1ccc(c(c1)N)Cl)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.