CAS 926201-78-7

4-[(Cyclopropylcarbonyl)amino]-2-fluorobenzenesulfonyl chloride

Description:

4-[(Cyclopropylcarbonyl)amino]-2-fluorobenzenesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. The presence of a fluorine atom on the benzene ring enhances the compound's electrophilicity, making it useful in various synthetic applications. The cyclopropylcarbonyl group contributes to the compound's unique steric and electronic properties, potentially influencing its reactivity and interactions with biological targets. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a versatile building block. Additionally, the sulfonyl chloride moiety can participate in nucleophilic substitution reactions, allowing for the introduction of various functional groups. Safety precautions are necessary when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Overall, its distinctive structure and functional groups make it a valuable compound in chemical research and development.

Formula: C₁₀H₉ClFNO₃S

InChI: InChI=1S/C10H9ClFNO3S/c11-17(15,16)9-4-3-7(5-8(9)12)13-10(14)6-1-2-6/h3-6H,1-2H2,(H,13,14)

InChI key: InChIKey=HBCPWRUZQDEUDP-UHFFFAOYSA-N

SMILES: N(C(=O)C1CC1)C2=CC(F)=C(S(Cl)(=O)=O)C=C2

Synonyms:

• 4-[(Cyclopropylcarbonyl)amino]-2-fluorobenzenesulfonyl chloride
• Benzenesulfonyl chloride, 4-[(cyclopropylcarbonyl)amino]-2-fluoro-