CAS 926201-89-0

4-[(Cyclopropylamino)methyl]phenol

Description:

4-[(Cyclopropylamino)methyl]phenol, identified by its CAS number 926201-89-0, is an organic compound characterized by the presence of a phenolic group and a cyclopropylamino side chain. This compound typically exhibits properties associated with both aromatic and amine functionalities, which can influence its solubility, reactivity, and biological activity. The phenolic hydroxyl group contributes to its potential as an antioxidant or a precursor in various chemical reactions, while the cyclopropylamino moiety may impart unique steric and electronic properties, affecting its interaction with biological targets. The compound may be of interest in medicinal chemistry for its potential pharmacological applications, particularly in the development of new therapeutic agents. Its structural features suggest it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in biological systems. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity.

Formula: C₁₀H₁₃NO

InChI: InChI=1S/C10H13NO/c12-10-5-1-8(2-6-10)7-11-9-3-4-9/h1-2,5-6,9,11-12H,3-4,7H2

InChI key: InChIKey=LKWSHXQLGSJANS-UHFFFAOYSA-N

SMILES: N(CC1=CC=C(O)C=C1)C2CC2

Synonyms:

• 4-[(Cyclopropylamino)methyl]phenol
• Phenol, 4-[(cyclopropylamino)methyl]-