CAS 926203-48-7

4-[5-amino-4-(ethoxycarbonyl)-1H-pyrazol-1-yl]benzoic acid

Description:

4-[5-amino-4-(ethoxycarbonyl)-1H-pyrazol-1-yl]benzoic acid, with the CAS number 926203-48-7, is a chemical compound that features a pyrazole ring substituted with an amino group and an ethoxycarbonyl group, along with a benzoic acid moiety. This compound is characterized by its potential biological activity, which may include anti-inflammatory or analgesic properties, making it of interest in pharmaceutical research. The presence of the carboxylic acid functional group contributes to its solubility in polar solvents and its ability to participate in acid-base reactions. The ethoxycarbonyl group enhances the compound's lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the pyrazole ring is known for its diverse reactivity and ability to form various derivatives, which can be explored for further functionalization. Overall, this compound exemplifies the complexity and versatility of organic molecules in medicinal chemistry, with potential applications in drug development and synthesis.

Formula: C₁₃H₁₃N₃O₄

InChI: InChI=1/C13H13N3O4/c1-2-20-13(19)10-7-15-16(11(10)14)9-5-3-8(4-6-9)12(17)18/h3-7H,2,14H2,1H3,(H,17,18)

4-[5-Amino-4-(ethoxycarbonyl)-1H-pyrazol-1-yl]benzoic acid

CAS: 926203-48-7

Versatile small molecule scaffold

Formula: C₁₃H₁₃N₃O₄

Purity: Min. 95%

Molecular weight: 275.26 g/mol

Ref: 3D-BMB20348