CymitQuimica logo

CAS 926205-46-1

:

2-(4-Methyl-1-piperidinyl)-3-pyridinamine

Description:
2-(4-Methyl-1-piperidinyl)-3-pyridinamine, with the CAS number 926205-46-1, is a chemical compound characterized by its unique structure, which includes a pyridinamine moiety and a piperidine ring substituted with a methyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the piperidine ring suggests that it may interact with various biological targets, potentially influencing neurotransmitter systems or other physiological pathways. Additionally, the amino group in the pyridine ring can participate in hydrogen bonding, enhancing its solubility in polar solvents. The compound's molecular structure may also impart specific pharmacokinetic properties, such as absorption and distribution characteristics, making it of interest in medicinal chemistry. Overall, 2-(4-Methyl-1-piperidinyl)-3-pyridinamine is a compound that may have applications in drug development, particularly in areas related to neuropharmacology or other therapeutic fields.
Formula:C11H17N3
InChI:InChI=1S/C11H17N3/c1-9-4-7-14(8-5-9)11-10(12)3-2-6-13-11/h2-3,6,9H,4-5,7-8,12H2,1H3
InChI key:InChIKey=JNBHCONHFUNVNI-UHFFFAOYSA-N
SMILES:NC1=C(N2CCC(C)CC2)N=CC=C1
Synonyms:
  • 2-(4-Methyl-1-piperidinyl)-3-pyridinamine
  • 3-Pyridinamine, 2-(4-methyl-1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.