CymitQuimica logo

CAS 926207-03-6

:

α-(Aminomethyl)-4-(difluoromethoxy)benzenemethanol

Description:
α-(Aminomethyl)-4-(difluoromethoxy)benzenemethanol, with the CAS number 926207-03-6, is a chemical compound characterized by its complex structure that includes an aminomethyl group and a difluoromethoxy substituent on a benzene ring. This compound typically exhibits properties associated with both amines and alcohols, such as potential hydrogen bonding due to the hydroxyl (-OH) group and basicity from the amine (-NH2) functionality. The presence of the difluoromethoxy group can influence its reactivity and solubility, often enhancing lipophilicity and altering electronic properties. Such compounds may be of interest in medicinal chemistry for their potential biological activity, particularly in the development of pharmaceuticals. The specific characteristics, including melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which the compound is studied. Overall, this compound represents a unique combination of functional groups that may contribute to its chemical behavior and potential applications in various fields.
Formula:C9H11F2NO2
InChI:InChI=1S/C9H11F2NO2/c10-9(11)14-7-3-1-6(2-4-7)8(13)5-12/h1-4,8-9,13H,5,12H2
InChI key:InChIKey=OSJPAJKRRGXALE-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=CC=C(C(CN)O)C=C1
Synonyms:
  • Benzenemethanol, α-(aminomethyl)-4-(difluoromethoxy)-
  • α-(Aminomethyl)-4-(difluoromethoxy)benzenemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.