CAS 926208-38-0

N-(4-Amino-2-chlorophenyl)-3-(methylsulfonyl)benzamide

Description:

N-(4-Amino-2-chlorophenyl)-3-(methylsulfonyl)benzamide, identified by its CAS number 926208-38-0, is a chemical compound characterized by its specific functional groups and structural features. It contains an amine group (-NH2), a sulfonyl group (-SO2-), and an amide linkage (-C(=O)N-), which contribute to its chemical reactivity and potential biological activity. The presence of a chlorine atom on the aromatic ring enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural motifs that are often associated with bioactive compounds. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. As with many organic compounds, safety and handling precautions are essential, especially considering the presence of the amino and sulfonyl groups, which may impart specific toxicological properties.

Formula: C₁₄H₁₃ClN₂O₃S

InChI: InChI=1S/C14H13ClN2O3S/c1-21(19,20)11-4-2-3-9(7-11)14(18)17-13-6-5-10(16)8-12(13)15/h2-8H,16H2,1H3,(H,17,18)

InChI key: InChIKey=YRXPJZAAILNCSG-UHFFFAOYSA-N

SMILES: C(NC1=C(Cl)C=C(N)C=C1)(=O)C2=CC(S(C)(=O)=O)=CC=C2

Synonyms:

• N-(4-Amino-2-chlorophenyl)-3-(methylsulfonyl)benzamide
• Benzamide, N-(4-amino-2-chlorophenyl)-3-(methylsulfonyl)-