
CAS 926211-25-8
:(4-Amino-1-piperidinyl)cyclobutylmethanone
Description:
(4-Amino-1-piperidinyl)cyclobutylmethanone, identified by its CAS number 926211-25-8, is a chemical compound characterized by its unique structural features. It contains a cyclobutyl group, which is a four-membered carbon ring, and a piperidine ring, a six-membered nitrogen-containing heterocycle. The presence of an amino group at the 4-position of the piperidine ring contributes to its basicity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. This compound may exhibit biological activity due to its structural similarity to various pharmacologically active molecules, making it of interest in medicinal chemistry. Its molecular interactions, stability, and potential applications in drug development are areas of ongoing research. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the sample. Safety data and handling precautions should be consulted when working with this substance, as with any chemical compound.
Formula:C10H18N2O
InChI:InChI=1S/C10H18N2O/c11-9-4-6-12(7-5-9)10(13)8-2-1-3-8/h8-9H,1-7,11H2
InChI key:InChIKey=AQACJKPILBMRGP-UHFFFAOYSA-N
SMILES:C(=O)(N1CCC(N)CC1)C2CCC2
Synonyms:- (4-Amino-1-piperidinyl)cyclobutylmethanone
- Methanone, (4-amino-1-piperidinyl)cyclobutyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.