CAS 926214-33-7
:1-(2-Methyl-1-oxopropyl)-3-piperidinecarboxylic acid
Description:
1-(2-Methyl-1-oxopropyl)-3-piperidinecarboxylic acid, with the CAS number 926214-33-7, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 2-methyl-1-oxopropyl substituent indicates that it has a branched alkyl chain, which can influence its solubility and interaction with biological systems. Generally, compounds like this may exhibit properties such as moderate to high solubility in polar solvents due to the carboxylic acid group, while the piperidine moiety can impart basic characteristics. The compound may also have implications in medicinal chemistry, potentially serving as a scaffold for drug development due to its structural features. However, specific biological activities, toxicity, and detailed physicochemical properties would require further investigation through experimental studies.
Formula:C10H17NO3
InChI:InChI=1S/C10H17NO3/c1-7(2)9(12)11-5-3-4-8(6-11)10(13)14/h7-8H,3-6H2,1-2H3,(H,13,14)
InChI key:InChIKey=AQQXGLGQEUMZDG-UHFFFAOYSA-N
SMILES:C(C(C)C)(=O)N1CC(C(O)=O)CCC1
Synonyms:- 1-(2-Methylpropanoyl)piperidine-3-carboxylic acid
- 1-(2-Methyl-1-oxopropyl)-3-piperidinecarboxylic acid
- 3-Piperidinecarboxylic acid, 1-(2-methyl-1-oxopropyl)-
- 1-Isobutyrylpiperidine-3-carboxylic acid
- 1-Isobutyryl-3-piperidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.