CAS 926214-34-8

2-Hydroxy-4-[(methylsulfonyl)amino]benzoic acid

Description:

2-Hydroxy-4-[(methylsulfonyl)amino]benzoic acid, also known by its CAS number 926214-34-8, is a chemical compound characterized by its aromatic structure, which includes a hydroxyl group and a methylsulfonylamino group attached to a benzoic acid framework. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the hydroxyl and sulfonyl functional groups, which can engage in hydrogen bonding. It is likely to display acidic behavior due to the carboxylic acid group, allowing it to participate in various chemical reactions, including esterification and amidation. The methylsulfonyl group can enhance the compound's biological activity, potentially influencing its pharmacological properties. Additionally, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential anti-inflammatory or analgesic effects, given its structural similarities to other known therapeutic agents. Overall, 2-Hydroxy-4-[(methylsulfonyl)amino]benzoic acid represents a versatile molecule with applications in both research and industry.

Formula: C₈H₉NO₅S

InChI: InChI=1S/C8H9NO5S/c1-15(13,14)9-5-2-3-6(8(11)12)7(10)4-5/h2-4,9-10H,1H3,(H,11,12)

InChI key: InChIKey=SALQNGMXNANWEI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(O)C=C(NS(C)(=O)=O)C=C1

Synonyms:

• 2-Hydroxy-4-[(methylsulfonyl)amino]benzoic acid
• 2-Hydroxy-4-(methanesulfonamido)benzoic acid
• Benzoic acid, 2-hydroxy-4-[(methylsulfonyl)amino]-

2-Hydroxy-4-methanesulfonamidobenzoic Acid

Controlled Product

CAS: 926214-34-8

Formula: C₈H₉NO₅S

Color and Shape: Neat

Molecular weight: 231.226

Ref: TR-H950403

2-Hydroxy-4-methanesulfonamidobenzoic acid

CAS: 926214-34-8

Versatile small molecule scaffold

Formula: C₈H₉NO₅S

Purity: Min. 95%

Molecular weight: 231.23 g/mol

Ref: 3D-BMB21434