CAS 926215-20-5
:4-(3-Aminobenzoyl)-2-piperazinone
Description:
4-(3-Aminobenzoyl)-2-piperazinone is a chemical compound characterized by its piperazinone structure, which includes a piperazine ring and an amide functional group. This compound features a benzoyl group substituted with an amino group at the meta position, contributing to its potential biological activity. The presence of the piperazine moiety often suggests properties related to pharmacological activity, as piperazine derivatives are commonly found in various therapeutic agents. The compound's molecular structure allows for hydrogen bonding and interactions with biological targets, which may influence its solubility and reactivity. Additionally, the amino group can participate in further chemical modifications, enhancing its utility in medicinal chemistry. The CAS number 926215-20-5 uniquely identifies this substance, facilitating its recognition in scientific literature and databases. Overall, 4-(3-Aminobenzoyl)-2-piperazinone represents a compound of interest in research, particularly in the fields of drug development and organic synthesis.
Formula:C11H13N3O2
InChI:InChI=1S/C11H13N3O2/c12-9-3-1-2-8(6-9)11(16)14-5-4-13-10(15)7-14/h1-3,6H,4-5,7,12H2,(H,13,15)
InChI key:InChIKey=ZCSSMKQLPZOTNL-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(N)=CC=C1)N2CC(=O)NCC2
Synonyms:- 2-Piperazinone, 4-(3-aminobenzoyl)-
- 4-(3-Aminobenzoyl)-2-piperazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.