CAS 926215-51-2

3-[(2,3-Dihydro-1H-inden-5-yl)sulfonyl]propanoic acid

Description:

3-[(2,3-Dihydro-1H-inden-5-yl)sulfonyl]propanoic acid, with the CAS number 926215-51-2, is a chemical compound characterized by its unique structure that includes a propanoic acid moiety and a sulfonyl group attached to a bicyclic indene derivative. This compound typically exhibits properties associated with both acidic and sulfonyl functional groups, which can influence its reactivity and solubility in various solvents. The presence of the sulfonyl group often enhances the compound's polarity, making it more soluble in polar solvents. Additionally, the bicyclic structure may contribute to specific steric and electronic properties, potentially affecting its biological activity and interactions with other molecules. Such compounds are of interest in medicinal chemistry and drug development due to their potential therapeutic applications. Overall, the characteristics of this compound suggest it may have unique chemical behavior and applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₂H₁₄O₄S

InChI: InChI=1S/C12H14O4S/c13-12(14)6-7-17(15,16)11-5-4-9-2-1-3-10(9)8-11/h4-5,8H,1-3,6-7H2,(H,13,14)

InChI key: InChIKey=DJFNDMWAGZHPAU-UHFFFAOYSA-N

SMILES: S(CCC(O)=O)(=O)(=O)C=1C=C2C(=CC1)CCC2

Synonyms:

• Propanoic acid, 3-[(2,3-dihydro-1H-inden-5-yl)sulfonyl]-
• 3-[(2,3-Dihydro-1H-inden-5-yl)sulfonyl]propanoic acid

3-(2,3-Dihydro-1H-indene-5-sulfonyl)propanoic acid

CAS: 926215-51-2

Versatile small molecule scaffold

Formula: C₁₂H₁₄O₄S

Purity: Min. 95%

Molecular weight: 254.3 g/mol

Ref: 3D-BMB21551