CAS 926217-21-2
:N-(2-aminophenyl)cyclopentanecarboxamide
Description:
N-(2-aminophenyl)cyclopentanecarboxamide, identified by its CAS number 926217-21-2, is an organic compound characterized by its amide functional group and a cyclopentane ring. This compound features a phenyl group substituted with an amino group at the ortho position relative to the carboxamide linkage, which can influence its reactivity and biological activity. The presence of the cyclopentane moiety contributes to its three-dimensional structure, potentially affecting its interactions with biological targets. Generally, compounds of this nature may exhibit properties such as moderate solubility in organic solvents and varying degrees of polarity, depending on the substituents present. The amino group can participate in hydrogen bonding, which may enhance its solubility in polar solvents and influence its pharmacokinetic properties. Additionally, the structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C12H16N2O
InChI:InChI=1/C12H16N2O/c13-10-7-3-4-8-11(10)14-12(15)9-5-1-2-6-9/h3-4,7-9H,1-2,5-6,13H2,(H,14,15)
SMILES:C1CCC(C1)C(=Nc1ccccc1N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.