CAS 926218-96-4

N-Hydroxy-5-methyl-1,2,4-oxadiazole-3-ethanimidamide

Description:

N-Hydroxy-5-methyl-1,2,4-oxadiazole-3-ethanimidamide is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. This compound features a hydroxylamine functional group, which can enhance its reactivity and solubility in various solvents. The presence of the methyl group on the oxadiazole ring may influence its electronic properties and steric hindrance, potentially affecting its interactions with biological targets. The ethanimidamide moiety suggests that the compound may exhibit properties relevant to medicinal chemistry, possibly acting as a precursor or intermediate in the synthesis of more complex molecules. Its CAS number, 926218-96-4, allows for precise identification in chemical databases and literature. Overall, the characteristics of this compound make it of interest in research areas such as drug development and material science, although specific applications and biological activities would require further investigation and validation through experimental studies.

Formula: C₅H₈N₄O₂

InChI: InChI=1S/C5H8N4O2/c1-3-7-5(9-11-3)2-4(6)8-10/h10H,2H2,1H3,(H2,6,8)

InChI key: InChIKey=MFSSENJFFKZDGE-UHFFFAOYSA-N

SMILES: C(C(NO)=N)C=1N=C(C)ON1

Synonyms:

• N-Hydroxy-5-methyl-1,2,4-oxadiazole-3-ethanimidamide
• 1,2,4-Oxadiazole-3-ethanimidamide, N-hydroxy-5-methyl-

(Z)-N'-Hydroxy-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethenimidamide

CAS: 926218-96-4

Versatile small molecule scaffold

Formula: C₈H₈N₄O₂S

Purity: Min. 95%

Molecular weight: 224.24 g/mol

Ref: 3D-BMB21896