CAS 926219-03-6
:N-(4-amino-2-chlorophenyl)-2-methoxyacetamide
Description:
N-(4-amino-2-chlorophenyl)-2-methoxyacetamide is an organic compound characterized by its specific functional groups and structural features. It contains an amine group (-NH2), a chloro substituent on the aromatic ring, and an acetamide moiety, which contributes to its potential biological activity. The presence of the methoxy group (-OCH3) enhances its solubility and may influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the amino and chloro groups, which can participate in various chemical reactions. Additionally, the compound's properties, such as solubility, melting point, and reactivity, can be influenced by the surrounding environment and the presence of other functional groups. As with many organic compounds, safety and handling precautions should be observed, as it may exhibit toxicity or other hazardous characteristics.
Formula:C9H11ClN2O2
InChI:InChI=1/C9H11ClN2O2/c1-14-5-9(13)12-8-3-2-6(11)4-7(8)10/h2-4H,5,11H2,1H3,(H,12,13)
SMILES:COCC(=Nc1ccc(cc1Cl)N)O
Synonyms:- AKOS BBV-008649
- N-(4-amino-2-chlorophenyl)-2-methoxyacetamide(SALTDATA: FREE)
- Acetamide, N-(4-amino-2-chlorophenyl)-2-methoxy-
- UKRORGSYN-BB BBV-008649
- N-(4-amino-2-chlorophenyl)-2-methoxyacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
