CAS 92622-81-6
:2-bromobenzenecarboximidamide
Description:
2-Bromobenzenecarboximidamide, with the CAS number 92622-81-6, is an organic compound characterized by the presence of a bromine atom attached to a benzene ring, which is further substituted with a carboximidamide functional group. This compound typically exhibits properties associated with both aromatic compounds and amides, including potential solubility in polar solvents due to the presence of the amide group. The bromine substituent can influence the compound's reactivity, making it a useful intermediate in various organic synthesis reactions, particularly in the development of pharmaceuticals and agrochemicals. The presence of the carboximidamide group suggests potential for hydrogen bonding, which may affect its physical properties such as melting and boiling points. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity and environmental impact.
Formula:C7H7BrN2
InChI:InChI=1/C7H7BrN2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H3,9,10)
SMILES:c1ccc(c(c1)C(=N)N)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

