CAS 926222-61-9
:N-(Cyclobutylcarbonyl)-N-methylglycine
Description:
N-(Cyclobutylcarbonyl)-N-methylglycine, with the CAS number 926222-61-9, is an organic compound characterized by its unique structure that includes a cyclobutylcarbonyl group and a methylglycine moiety. This compound features a cyclobutane ring, which contributes to its rigidity and potential steric effects. The presence of the carbonyl group indicates that it can participate in various chemical reactions, such as acylation or amidation. As an amino acid derivative, it may exhibit properties typical of amino acids, including potential solubility in polar solvents and the ability to form hydrogen bonds. The methyl group attached to the nitrogen atom can influence its steric and electronic properties, potentially affecting its reactivity and interactions with biological systems. This compound may have applications in medicinal chemistry or as a building block in the synthesis of more complex molecules. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require further investigation or experimental determination.
Formula:C8H13NO3
InChI:InChI=1S/C8H13NO3/c1-9(5-7(10)11)8(12)6-3-2-4-6/h6H,2-5H2,1H3,(H,10,11)
InChI key:InChIKey=FQBUYALBYNYAFC-UHFFFAOYSA-N
SMILES:C(N(CC(O)=O)C)(=O)C1CCC1
Synonyms:- N-(Cyclobutylcarbonyl)-N-methylglycine
- Glycine, N-(cyclobutylcarbonyl)-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.