CymitQuimica logo

CAS 926222-63-1

:

3-amino-N-(2-methoxyethyl)-2-methylbenzamide

Description:
3-Amino-N-(2-methoxyethyl)-2-methylbenzamide is an organic compound characterized by its amide functional group, which is derived from the reaction of an amine with a carboxylic acid. This compound features a benzene ring substituted with an amino group at the 3-position and a methyl group at the 2-position, contributing to its aromatic properties. The presence of a methoxyethyl group enhances its solubility in organic solvents and may influence its biological activity. The molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its CAS number, 926222-63-1, allows for precise identification in chemical databases. The compound is likely to exhibit moderate polarity due to the combination of hydrophilic (amine and methoxy) and hydrophobic (aromatic and methyl) components, which can affect its behavior in various chemical environments. Overall, this compound's unique structure may provide insights into its reactivity, stability, and potential applications in pharmaceuticals or agrochemicals.
Formula:C11H16N2O2
InChI:InChI=1/C11H16N2O2/c1-8-9(4-3-5-10(8)12)11(14)13-6-7-15-2/h3-5H,6-7,12H2,1-2H3,(H,13,14)
SMILES:Cc1c(cccc1N)C(=NCCOC)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.