CAS 926226-12-2

2-(3-fluorophenyl)-1-(piperazin-1-yl)ethanone

Description:

2-(3-fluorophenyl)-1-(piperazin-1-yl)ethanone, identified by its CAS number 926226-12-2, is a chemical compound characterized by its unique structure, which includes a piperazine ring and a fluorophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the fluorine atom on the phenyl ring can enhance lipophilicity and influence the compound's interaction with biological targets. It is often studied in medicinal chemistry for its potential pharmacological applications, particularly in the development of therapeutic agents. The piperazine moiety is known for its role in various drug formulations, providing structural stability and influencing receptor binding. Additionally, the compound's reactivity may be influenced by the carbonyl group, which can participate in various chemical reactions. Overall, 2-(3-fluorophenyl)-1-(piperazin-1-yl)ethanone represents a class of compounds that may exhibit interesting properties for further research in drug discovery and development.

Formula: C₁₂H₁₅FN₂O

InChI: InChI=1/C12H15FN2O/c13-11-3-1-2-10(8-11)9-12(16)15-6-4-14-5-7-15/h1-3,8,14H,4-7,9H2

SMILES: c1cc(cc(c1)F)CC(=O)N1CCNCC1

Synonyms:

• 1-[(3-Fluorophenyl)acetyl]piperazine
• Ethanone, 2-(3-Fluorophenyl)-1-(1-Piperazinyl)-
• 2-(3-Fluorophenyl)-1-(piperazin-1-yl)ethanone