CAS 926227-00-1

N-[3-(Aminomethyl)phenyl]-2-furancarboxamide

Description:

N-[3-(Aminomethyl)phenyl]-2-furancarboxamide, identified by its CAS number 926227-00-1, is a chemical compound characterized by its unique structural features. It contains a furan ring, which is a five-membered aromatic ring with oxygen, and an amide functional group, indicating its potential for hydrogen bonding and solubility in polar solvents. The presence of the aminomethyl group attached to a phenyl ring suggests that this compound may exhibit biological activity, possibly interacting with various biological targets. Its molecular structure implies that it could participate in various chemical reactions, including nucleophilic substitutions and acylation. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Additionally, its potential applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and reactivity. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₂H₁₂N₂O₂

InChI: InChI=1S/C12H12N2O2/c13-8-9-3-1-4-10(7-9)14-12(15)11-5-2-6-16-11/h1-7H,8,13H2,(H,14,15)

InChI key: InChIKey=YFHUTGIMZXHIFQ-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=CO1)C2=CC(CN)=CC=C2

Synonyms:

• 2-Furancarboxamide, N-[3-(aminomethyl)phenyl]-
• N-[3-(Aminomethyl)phenyl]-2-furancarboxamide