CAS 926227-21-6
:N-(4-amino-2-methylphenyl)cyclopentanecarboxamide
Description:
N-(4-amino-2-methylphenyl)cyclopentanecarboxamide, identified by its CAS number 926227-21-6, is a chemical compound characterized by its unique structure, which includes a cyclopentanecarboxamide moiety linked to an amino-substituted aromatic ring. This compound features an amine group (-NH2) attached to a phenyl ring that has a methyl group at the 2-position, contributing to its hydrophobic characteristics. The cyclopentane ring adds a degree of rigidity and influences the compound's spatial configuration, which can affect its biological activity and interactions. Typically, such compounds may exhibit properties relevant to medicinal chemistry, including potential pharmacological effects. The presence of both polar (amine and carboxamide) and non-polar (aromatic and cyclopentane) functional groups suggests that it may engage in various intermolecular interactions, such as hydrogen bonding and hydrophobic interactions. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to elucidate its specific applications and biological activities.
Formula:C13H18N2O
InChI:InChI=1/C13H18N2O/c1-9-8-11(14)6-7-12(9)15-13(16)10-4-2-3-5-10/h6-8,10H,2-5,14H2,1H3,(H,15,16)
SMILES:Cc1cc(ccc1NC(=O)C1CCCC1)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.