CAS 926227-56-7

2,5-Difluoro-N,α-dimethylbenzenemethanamine

Description:

2,5-Difluoro-N,α-dimethylbenzenemethanamine, with the CAS number 926227-56-7, is an organic compound characterized by its unique structure, which includes a benzene ring substituted with two fluorine atoms and a dimethylamino group. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The dimethylamino group contributes to the compound's basicity and potential as a ligand in various chemical reactions. This compound may exhibit interesting properties such as increased stability and altered solubility compared to its non-fluorinated counterparts. Its applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and interactions with biological systems. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses. As with many fluorinated compounds, safety precautions should be taken due to the potential for unique environmental and health effects.

Formula: C₉H₁₁F₂N

InChI: InChI=1S/C9H11F2N/c1-6(12-2)8-5-7(10)3-4-9(8)11/h3-6,12H,1-2H3

InChI key: InChIKey=SRVVQVRSBZVYPA-UHFFFAOYSA-N

SMILES: C(NC)(C)C1=C(F)C=CC(F)=C1

Synonyms:

• 2,5-Difluoro-N,α-dimethylbenzenemethanamine
• Benzenemethanamine, 2,5-difluoro-N,α-dimethyl-
• [1-(2,5-Difluorophenyl)ethyl](methyl)amine

[1-(2,5-Difluorophenyl)ethyl](methyl)amine

CAS: 926227-56-7

2,5-Difluoroaniline is an organic compound that belongs to the class of phenylalkylamines. It is a colorless liquid with a boiling point of 154°C and a density of 1.14 g/mL. 2,5-Difluoroaniline is used as a reagent for the synthesis of other compounds and as an intermediate in the preparation of pharmaceuticals such as fluoxetine (Prozac). It has also been used in research to study ion channels, protein interactions, and cell biology.

Formula: C₉H₁₁F₂N

Purity: Min. 95%

Molecular weight: 171.19 g/mol

Ref: 3D-BMB22756