CymitQuimica logo

CAS 926227-66-9

:

(4-Chloro-2-fluorophenyl)-1-piperazinylmethanone

Description:
(4-Chloro-2-fluorophenyl)-1-piperazinylmethanone, with the CAS number 926227-66-9, is a chemical compound characterized by its unique structure, which includes a piperazine ring and a substituted phenyl group. The presence of chlorine and fluorine atoms on the phenyl ring contributes to its potential biological activity and lipophilicity, influencing its interaction with biological targets. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many piperazine derivatives. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperazine moiety's known role in enhancing pharmacological properties. Additionally, the specific halogen substitutions may affect the compound's reactivity and stability, making it of interest for further research in drug design and synthesis. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C11H12ClFN2O
InChI:InChI=1S/C11H12ClFN2O/c12-8-1-2-9(10(13)7-8)11(16)15-5-3-14-4-6-15/h1-2,7,14H,3-6H2
InChI key:InChIKey=GWHUAVWOVBAHJE-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(F)C=C(Cl)C=C1)N2CCNCC2
Synonyms:
  • Methanone, (4-chloro-2-fluorophenyl)-1-piperazinyl-
  • (4-Chloro-2-fluorophenyl)-1-piperazinylmethanone
Found 0 products.