
CAS 926227-69-2
:2-[4-(Aminomethyl)phenoxy]-N-methylacetamide
Description:
2-[4-(Aminomethyl)phenoxy]-N-methylacetamide, identified by its CAS number 926227-69-2, is a chemical compound characterized by its structural features that include an aminomethyl group and a phenoxy moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential hydrogen bonding capabilities due to the presence of both an amine and an amide functional group. The phenoxy group contributes to its aromatic character, which can influence its reactivity and interaction with biological systems. Additionally, the N-methyl group may enhance lipophilicity, affecting its pharmacokinetic properties if considered for pharmaceutical applications. The compound's specific characteristics, including melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, its unique structure suggests potential utility in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C10H14N2O2
InChI:InChI=1S/C10H14N2O2/c1-12-10(13)7-14-9-4-2-8(6-11)3-5-9/h2-5H,6-7,11H2,1H3,(H,12,13)
InChI key:InChIKey=FHHCAEQUMYZSAV-UHFFFAOYSA-N
SMILES:O(CC(NC)=O)C1=CC=C(CN)C=C1
Synonyms:- 2-[4-(Aminomethyl)phenoxy]-N-methylacetamide
- Acetamide, 2-[4-(aminomethyl)phenoxy]-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.