
CAS 926231-31-4
:N-(3-Amino-4-chlorophenyl)tetrahydro-2-furancarboxamide
Description:
N-(3-Amino-4-chlorophenyl)tetrahydro-2-furancarboxamide, identified by its CAS number 926231-31-4, is a chemical compound that features a tetrahydrofuran ring fused with an amide functional group. This compound is characterized by the presence of an amino group and a chlorophenyl moiety, which contribute to its potential biological activity. The tetrahydrofuran structure provides a cyclic ether framework, while the carboxamide group enhances its solubility and reactivity. The chlorophenyl substituent may influence the compound's interaction with biological targets, making it of interest in medicinal chemistry. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific therapeutic effects. Additionally, the presence of both polar and non-polar regions in its molecular structure may affect its pharmacokinetic properties, such as absorption and distribution in biological systems. Overall, this compound's characteristics make it a subject of interest for further research in various chemical and biological contexts.
Formula:C11H13ClN2O2
InChI:InChI=1S/C11H13ClN2O2/c12-8-4-3-7(6-9(8)13)14-11(15)10-2-1-5-16-10/h3-4,6,10H,1-2,5,13H2,(H,14,15)
InChI key:InChIKey=JQKCJILTKBDZSH-UHFFFAOYSA-N
SMILES:N(C(=O)C1CCCO1)C2=CC(N)=C(Cl)C=C2
Synonyms:- 2-Furancarboxamide, N-(3-amino-4-chlorophenyl)tetrahydro-
- N-(3-Amino-4-chlorophenyl)tetrahydro-2-furancarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.