
CAS 926231-59-6
:N-(2-Furanylmethyl)-α-methyl-4-pyridinemethanamine
Description:
N-(2-Furanylmethyl)-α-methyl-4-pyridinemethanamine, with the CAS number 926231-59-6, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a furan moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the furan group may impart specific electronic characteristics, influencing its interaction with biological targets. Additionally, the α-methyl group on the pyridine ring can affect the compound's steric and electronic properties, potentially enhancing its lipophilicity and membrane permeability. Such features may make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, N-(2-Furanylmethyl)-α-methyl-4-pyridinemethanamine represents a class of compounds that may exhibit diverse biological activities, warranting further investigation for potential applications in drug development and other fields.
Formula:C12H14N2O
InChI:InChI=1S/C12H14N2O/c1-10(11-4-6-13-7-5-11)14-9-12-3-2-8-15-12/h2-8,10,14H,9H2,1H3
InChI key:InChIKey=IUBSESDUDLGHGU-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CO1)(C)C=2C=CN=CC2
Synonyms:- 4-Pyridinemethanamine, N-(2-furanylmethyl)-α-methyl-
- N-(2-Furanylmethyl)-α-methyl-4-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.