
CAS 926231-95-0
:N-Cyclopropyl-2-methoxy-α,5-dimethylbenzenemethanamine
Description:
N-Cyclopropyl-2-methoxy-α,5-dimethylbenzenemethanamine, with the CAS number 926231-95-0, is a chemical compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring, contributing to its potential reactivity and steric properties. The presence of a methoxy group (–OCH3) enhances its solubility in organic solvents and may influence its biological activity. The α,5-dimethyl substitution on the benzene ring indicates that there are two methyl groups attached to the aromatic system, which can affect the compound's electronic properties and sterics. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its specific interactions with biological targets would depend on its three-dimensional conformation and the functional groups present. As with many organic compounds, its stability, reactivity, and potential applications would be influenced by environmental conditions such as temperature and pH. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C13H19NO
InChI:InChI=1S/C13H19NO/c1-9-4-7-13(15-3)12(8-9)10(2)14-11-5-6-11/h4,7-8,10-11,14H,5-6H2,1-3H3
InChI key:InChIKey=WJWUPLSMTLDPIM-UHFFFAOYSA-N
SMILES:C(NC1CC1)(C)C2=C(OC)C=CC(C)=C2
Synonyms:- Benzenemethanamine, N-cyclopropyl-2-methoxy-α,5-dimethyl-
- N-Cyclopropyl-2-methoxy-α,5-dimethylbenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.