CAS 926232-19-1
:3-chloro-N~2~,N~2~-diethylbenzene-1,2-diamine
Description:
3-Chloro-N2,N2-diethylbenzene-1,2-diamine is an organic compound characterized by its structure, which includes a benzene ring substituted with a chlorine atom and two diethylamine groups. This compound features a primary amine functional group, which contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions. The presence of the chlorine atom enhances its electrophilic character, making it useful in synthetic organic chemistry. The diethyl groups provide steric hindrance, influencing the compound's solubility and interaction with other molecules. Typically, compounds like this may exhibit moderate to high polarity due to the amine groups, affecting their solubility in polar solvents. Additionally, the compound may have biological activity, making it of interest in pharmaceutical research. Safety data should be consulted, as compounds with amine and halogen functionalities can pose health risks. Overall, 3-chloro-N2,N2-diethylbenzene-1,2-diamine is a versatile compound with potential applications in both industrial and research settings.
Formula:C10H15ClN2
InChI:InChI=1/C10H15ClN2/c1-3-13(4-2)10-8(11)6-5-7-9(10)12/h5-7H,3-4,12H2,1-2H3
SMILES:CCN(CC)c1c(cccc1N)Cl
Synonyms:- N-(2-amino-6-chlorophenyl)-N,N-diethylamine
- 6-CHLORO-N1,N1-DIETHYLBENZENE-1,2-DIAMINE
- (2-amino-6-chlorophenyl)diethylamine(SALTDATA: FREE)
- 1,2-Benzenediamine, 3-chloro-N2,N2-diethyl-
- (2-amino-6-chlorophenyl)diethylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
