CymitQuimica logo

CAS 926233-19-4

:

2-[3-(Aminomethyl)phenoxy]-N-cyclopropylacetamide

Description:
2-[3-(Aminomethyl)phenoxy]-N-cyclopropylacetamide, identified by its CAS number 926233-19-4, is a chemical compound characterized by its unique structural features. It contains a cyclopropyl group, which contributes to its potential biological activity, and an aminomethyl group attached to a phenoxy moiety, indicating the presence of an aromatic ring. This compound is likely to exhibit properties associated with amides, such as stability under various conditions and potential solubility in organic solvents. The presence of the aminomethyl group suggests it may engage in hydrogen bonding, influencing its reactivity and interactions with biological targets. Additionally, the cyclopropyl group can impart strain, which may enhance the compound's reactivity or selectivity in chemical reactions. Overall, this compound may be of interest in medicinal chemistry and pharmacology, potentially serving as a lead compound for the development of therapeutic agents. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c13-7-9-2-1-3-11(6-9)16-8-12(15)14-10-4-5-10/h1-3,6,10H,4-5,7-8,13H2,(H,14,15)
InChI key:InChIKey=BRPBYHULVCFBJT-UHFFFAOYSA-N
SMILES:O(CC(NC1CC1)=O)C2=CC(CN)=CC=C2
Synonyms:
  • 2-[3-(Aminomethyl)phenoxy]-N-cyclopropylacetamide
  • Acetamide, 2-[3-(aminomethyl)phenoxy]-N-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.