CymitQuimica logo

CAS 926234-74-4

:

N-(5-Amino-2-methoxyphenyl)-2-methoxybenzamide

Description:
N-(5-Amino-2-methoxyphenyl)-2-methoxybenzamide, identified by its CAS number 926234-74-4, is an organic compound characterized by its amide functional group and aromatic structure. This compound features a methoxy group, which enhances its solubility and reactivity, and an amino group that can participate in various chemical reactions, including hydrogen bonding and nucleophilic substitution. The presence of two methoxy groups contributes to its electronic properties, potentially influencing its biological activity and interaction with other molecules. The compound's structure suggests it may exhibit properties relevant to medicinal chemistry, possibly serving as a scaffold for drug development. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the purity and specific conditions under which it is studied. Overall, N-(5-Amino-2-methoxyphenyl)-2-methoxybenzamide represents a compound of interest in both synthetic and pharmaceutical chemistry due to its functional groups and potential applications.
Formula:C15H16N2O3
InChI:InChI=1S/C15H16N2O3/c1-19-13-6-4-3-5-11(13)15(18)17-12-9-10(16)7-8-14(12)20-2/h3-9H,16H2,1-2H3,(H,17,18)
InChI key:InChIKey=RISVRBYNFQNFHG-UHFFFAOYSA-N
SMILES:C(NC1=C(OC)C=CC(N)=C1)(=O)C2=C(OC)C=CC=C2
Synonyms:
  • N-(5-Amino-2-methoxyphenyl)-2-methoxybenzamide
  • Benzamide, N-(5-amino-2-methoxyphenyl)-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.