CAS 926234-83-5

6-Bromo-2-[2-(3-bromophenyl)ethenyl]-4-quinolinecarboxylic acid

Description:

6-Bromo-2-[2-(3-bromophenyl)ethenyl]-4-quinolinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with bromine and a vinyl group. This compound features a brominated phenyl group attached to a vinyl chain, contributing to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the carboxylic acid functional group indicates that it can participate in various chemical reactions, such as esterification and amidation, making it versatile for further derivatization. Additionally, the bromine atoms in the structure may enhance its biological activity and influence its interaction with biological targets. The compound's molecular structure suggests potential uses in pharmaceuticals, particularly in the development of anti-cancer or anti-inflammatory agents, due to the known activity of quinoline derivatives. Its specific properties, such as solubility, melting point, and spectral characteristics, would need to be determined experimentally for practical applications.

Formula: C₁₈H₁₁Br₂NO₂

InChI: InChI=1S/C18H11Br2NO2/c19-12-3-1-2-11(8-12)4-6-14-10-16(18(22)23)15-9-13(20)5-7-17(15)21-14/h1-10H,(H,22,23)

InChI key: InChIKey=LDARHISNYXBFEC-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C=CC3=CC(Br)=CC=C3)C1)C=CC(Br)=C2

Synonyms:

• 6-Bromo-2-[2-(3-bromophenyl)ethenyl]-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 6-bromo-2-[2-(3-bromophenyl)ethenyl]-

6-Bromo-2-[2-(3-bromophenyl)ethenyl]quinoline-4-carboxylic acid

CAS: 926234-83-5

Versatile small molecule scaffold

Formula: C₁₈H₁₁Br₂NO₂

Purity: Min. 95%

Molecular weight: 433.1 g/mol

Ref: 3D-BMB23483