CAS 926235-03-2

3′,4′-Dichloro-3-fluoro[1,1′-biphenyl]-4-carboxylic acid

Description:

3′,4′-Dichloro-3-fluoro[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms and one fluorine atom at specific positions on the biphenyl framework contributes to its unique reactivity and physical properties. The carboxylic acid functional group (-COOH) at one end of the molecule enhances its acidity and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests potential applications in the synthesis of more complex organic molecules or as an intermediate in chemical reactions. Additionally, the presence of halogen substituents can influence the compound's electronic properties, potentially affecting its interactions with biological targets or its behavior in various chemical environments. Safety and handling precautions should be observed due to the presence of halogens, which can pose environmental and health risks.

Formula: C₁₃H₇Cl₂FO₂

InChI: InChI=1S/C13H7Cl2FO2/c14-10-4-2-7(5-11(10)15)8-1-3-9(13(17)18)12(16)6-8/h1-6H,(H,17,18)

InChI key: InChIKey=IUFAIVVWQHHJJL-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1C(O)=O)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• 3′,4′-Dichloro-3-fluoro[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 3′,4′-dichloro-3-fluoro-

4-(3,4-Dichlorophenyl)-2-fluorobenzoic acid

CAS: 926235-03-2

Versatile small molecule scaffold

Formula: C₁₃H₇Cl₂FO₂

Purity: Min. 95%

Molecular weight: 285.09 g/mol

Ref: 3D-BMB23503