CAS 926237-37-8
:N-(3-amino-2-methylphenyl)-3-methylbutanamide
Description:
N-(3-amino-2-methylphenyl)-3-methylbutanamide, identified by its CAS number 926237-37-8, is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a substituted aromatic ring, specifically a 2-methylphenyl group, which contributes to its unique chemical properties. The presence of the amino group enhances its potential for hydrogen bonding, influencing its solubility and reactivity. The 3-methylbutanamide portion of the molecule indicates a branched aliphatic chain, which can affect its steric properties and overall molecular interactions. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential applications in medicinal chemistry, where modifications can lead to variations in potency and selectivity for biological targets. Overall, the characteristics of this compound highlight its complexity and potential utility in various chemical and biological contexts.
Formula:C12H18N2O
InChI:InChI=1/C12H18N2O/c1-8(2)7-12(15)14-11-6-4-5-10(13)9(11)3/h4-6,8H,7,13H2,1-3H3,(H,14,15)
SMILES:CC(C)CC(=Nc1cccc(c1C)N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.